C9H19N3O — CID 144540771
N-(2-iminobut-3-enyl)butanamide;methanimine;molecular hydrogen (PubChem CID 144540771) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(2-iminobut-3-enyl)butanamide;methanimine;molecular hydrogen.
| Compound Name | N-(2-iminobut-3-enyl)butanamide;methanimine;molecular hydrogen |
|---|---|
| PubChem CID | 144540771 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N-(2-iminobut-3-enyl)butanamide;methanimine;molecular hydrogen |
| SMILES | [H]/N=C(\C=C)CNC(=O)CCC.[H]N=C.[H][H] |
| InChI | InChI=1S/C8H14N2O.CH3N.H2/c1-3-5-8(11)10-6-7(9)4-2;1-2;/h4,9H,2-3,5-6H2,1H3,(H,10,11);2H,1H2;1H/b9-7+;; |
| InChIKey | KINADHOLTQXPID-OJYIHNBOSA-N |
| XLogP | 1.62 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|