C16H10O4 — CID 144541091
4-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxoprop-1-enyl]benzoic acid (PubChem CID 144541091) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 144541091 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yloxy-3-oxoprop-1-enyl]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(C(=O)O)cc1)Oc1cc#ccc1 |
| InChI | InChI=1S/C16H10O4/c17-15(20-14-4-2-1-3-5-14)11-8-12-6-9-13(10-7-12)16(18)19/h2,4-11H,(H,18,19)/b11-8+ |
| InChIKey | NTPPZGGPGGIHQG-DHZHZOJOSA-N |
| XLogP | 2.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|