C26H38N4OS — CID 144541532
(3Z)-3-[amino-(4-tert-butylphenyl)methylidene]-1-[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl]-1-(hydroxymethyl)thiourea (PubChem CID 144541532) has the molecular formula C26H38N4OS and a molecular weight of 454.68 g/mol. Its IUPAC name is (3Z)-3-[amino-(4-tert-butylphenyl)methylidene]-1-[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl]-1-(hydroxymethyl)thiourea.
| Compound Name | (3Z)-3-[amino-(4-tert-butylphenyl)methylidene]-1-[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl]-1-(hydroxymethyl)thiourea |
|---|---|
| PubChem CID | 144541532 |
| Molecular Formula | C26H38N4OS |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (3Z)-3-[amino-(4-tert-butylphenyl)methylidene]-1-[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl]-1-(hydroxymethyl)thiourea |
| SMILES | CCN(C)CCc1cc(C)c(N(CO)C(=S)/N=C(\N)c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C26H38N4OS/c1-8-29(7)14-13-21-15-19(3)23(16-18(21)2)30(17-31)25(32)28-24(27)20-9-11-22(12-10-20)26(4,5)6/h9-12,15-16,31H,8,13-14,17H2,1-7H3,(H2,27,28,32) |
| InChIKey | XKOSJYPHDGJKJG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|