C25H33N4O2S+ — CID 144542158
[N-[4-(2-cyanopropan-2-yl)benzenecarboximidoyl]-C-[4-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylphenoxy]carbonimidoyl]sulfanium (PubChem CID 144542158) has the molecular formula C25H33N4O2S+ and a molecular weight of 453.63 g/mol. Its IUPAC name is [N-[4-(2-cyanopropan-2-yl)benzenecarboximidoyl]-C-[4-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylphenoxy]carbonimidoyl]sulfanium.
| Compound Name | [N-[4-(2-cyanopropan-2-yl)benzenecarboximidoyl]-C-[4-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylphenoxy]carbonimidoyl]sulfanium |
|---|---|
| PubChem CID | 144542158 |
| Molecular Formula | C25H33N4O2S+ |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [N-[4-(2-cyanopropan-2-yl)benzenecarboximidoyl]-C-[4-[2-[ethyl(methyl)amino]ethyl]-2-methoxy-5-methylphenoxy]carbonimidoyl]sulfanium |
| SMILES | [H]/N=C(/N=C(\[SH2+])Oc1cc(C)c(CCN(C)CC)cc1OC)c1ccc(C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C25H32N4O2S/c1-7-29(5)13-12-19-15-21(30-6)22(14-17(19)2)31-24(32)28-23(27)18-8-10-20(11-9-18)25(3,4)16-26/h8-11,14-15H,7,12-13H2,1-6H3,(H2,27,28,32)/p+1 |
| InChIKey | OVAGBBUCVPSYCT-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|