About [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate
[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate (PubChem CID 144541831) has the molecular formula C20H26N2O2
and a molecular weight of 326.44 g/mol. Its IUPAC name is [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate.
Molecular Properties
| Compound Name | [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate |
| PubChem CID | 144541831 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate |
| SMILES | [H]/N=C(/Oc1cc(C)c(CCN(C)CC)cc1C)c1ccccc1O |
| InChI | InChI=1S/C20H26N2O2/c1-5-22(4)11-10-16-12-15(3)19(13-14(16)2)24-20(21)17-8-6-7-9-18(17)23/h6-9,12-13,21,23H,5,10-11H2,1-4H3/b21-20+ |
| InChIKey | KGHTXBPYFFBJPO-QZQOTICOSA-N |
| XLogP | 3.91 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate?
The IUPAC name of [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate (CID 144541831) is [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate.
What is the SMILES notation for [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate?
The canonical SMILES for [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate is [H]/N=C(/Oc1cc(C)c(CCN(C)CC)cc1C)c1ccccc1O.
What is the InChIKey of [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate?
The InChIKey is KGHTXBPYFFBJPO-QZQOTICOSA-N. The full InChI is InChI=1S/C20H26N2O2/c1-5-22(4)11-10-16-12-15(3)19(13-14(16)2)24-20(21)17-8-6-7-9-18(17)23/h6-9,12-13,21,23H,5,10-11H2,1-4H3/b21-20+.
What are the key properties of [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate?
[4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate has a molecular weight of 326.44 g/mol, XLogP of 3.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[ethyl(methyl)amino]ethyl]-2,5-dimethylphenyl] 2-hydroxybenzenecarboximidate is sourced from PubChem (CID 144541831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).