About 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane
5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane (PubChem CID 144542057) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane.
Molecular Properties
| Compound Name | 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane |
| PubChem CID | 144542057 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(\N=C)c1cc(C)c(C(C)(C)C)cn1 |
| InChI | InChI=1S/C12H17N3.C2H6/c1-8-6-10(11(13)14-5)15-7-9(8)12(2,3)4;1-2/h6-7,13H,5H2,1-4H3;1-2H3/b13-11-; |
| InChIKey | YRUCIWDDCGSPJG-KEHAOADBSA-N |
| XLogP | 3.74 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane?
The IUPAC name of 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane (CID 144542057) is 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane.
What is the SMILES notation for 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane?
The canonical SMILES for 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane is CC.[H]/N=C(\N=C)c1cc(C)c(C(C)(C)C)cn1.
What is the InChIKey of 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane?
The InChIKey is YRUCIWDDCGSPJG-KEHAOADBSA-N. The full InChI is InChI=1S/C12H17N3.C2H6/c1-8-6-10(11(13)14-5)15-7-9(8)12(2,3)4;1-2/h6-7,13H,5H2,1-4H3;1-2H3/b13-11-;.
What are the key properties of 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane?
5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane has a molecular weight of 233.36 g/mol, XLogP of 3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-4-methyl-N-methylidenepyridine-2-carboximidamide;ethane is sourced from PubChem (CID 144542057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).