C20H20N2O2 — CID 144545615
2-[4-(3-ethyl-5-methyl-6-oxo-1H-pyridin-2-yl)phenyl]-2-azabicyclo[2.2.1]hept-5-en-3-one (PubChem CID 144545615) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[4-(3-ethyl-5-methyl-6-oxo-1H-pyridin-2-yl)phenyl]-2-azabicyclo[2.2.1]hept-5-en-3-one.
| Compound Name | 2-[4-(3-ethyl-5-methyl-6-oxo-1H-pyridin-2-yl)phenyl]-2-azabicyclo[2.2.1]hept-5-en-3-one |
|---|---|
| PubChem CID | 144545615 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[4-(3-ethyl-5-methyl-6-oxo-1H-pyridin-2-yl)phenyl]-2-azabicyclo[2.2.1]hept-5-en-3-one |
| SMILES | CCc1cc(C)c(=O)[nH]c1-c1ccc(N2C(=O)C3C=CC2C3)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-13-10-12(2)19(23)21-18(13)14-4-7-16(8-5-14)22-17-9-6-15(11-17)20(22)24/h4-10,15,17H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | SMWDZXGYWBNRPP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|