C10H11NO — CID 144546014
3-methyl-6,7-dihydro-1H-quinolin-2-one (PubChem CID 144546014) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-1H-quinolin-2-one.
| Compound Name | 3-methyl-6,7-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 144546014 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-methyl-6,7-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc2c([nH]c1=O)=CCCC=2 |
| InChI | InChI=1S/C10H11NO/c1-7-6-8-4-2-3-5-9(8)11-10(7)12/h4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | ORGSUKUSBBEUBF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |