C14H23NO — CID 144549752
2-[cyclohexa-1,5-dien-1-yl(ethoxy)methyl]piperidine (PubChem CID 144549752) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-[cyclohexa-1,5-dien-1-yl(ethoxy)methyl]piperidine.
| Compound Name | 2-[cyclohexa-1,5-dien-1-yl(ethoxy)methyl]piperidine |
|---|---|
| PubChem CID | 144549752 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-[cyclohexa-1,5-dien-1-yl(ethoxy)methyl]piperidine |
| SMILES | CCOC(C1=CCCC=C1)C1CCCCN1 |
| InChI | InChI=1S/C14H23NO/c1-2-16-14(12-8-4-3-5-9-12)13-10-6-7-11-15-13/h4,8-9,13-15H,2-3,5-7,10-11H2,1H3 |
| InChIKey | KSKMSJHAFAVXHO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |