About N-butylpent-4-yn-2-amine;ethane
N-butylpent-4-yn-2-amine;ethane (PubChem CID 144551076) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is N-butylpent-4-yn-2-amine;ethane.
Molecular Properties
| Compound Name | N-butylpent-4-yn-2-amine;ethane |
| PubChem CID | 144551076 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-butylpent-4-yn-2-amine;ethane |
| SMILES | C#CCC(C)NCCCC.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-4-6-8-10-9(3)7-5-2;1-2/h2,9-10H,4,6-8H2,1,3H3;1-2H3 |
| InChIKey | GDSGUGIVMUJEIF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butylpent-4-yn-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylpent-4-yn-2-amine;ethane?
The IUPAC name of N-butylpent-4-yn-2-amine;ethane (CID 144551076) is N-butylpent-4-yn-2-amine;ethane.
What is the SMILES notation for N-butylpent-4-yn-2-amine;ethane?
The canonical SMILES for N-butylpent-4-yn-2-amine;ethane is C#CCC(C)NCCCC.CC.
What is the InChIKey of N-butylpent-4-yn-2-amine;ethane?
The InChIKey is GDSGUGIVMUJEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C2H6/c1-4-6-8-10-9(3)7-5-2;1-2/h2,9-10H,4,6-8H2,1,3H3;1-2H3.
What are the key properties of N-butylpent-4-yn-2-amine;ethane?
N-butylpent-4-yn-2-amine;ethane has a molecular weight of 169.31 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylpent-4-yn-2-amine;ethane is sourced from PubChem (CID 144551076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).