C35H54O9 — CID 144551382
[(1S)-2-hydroxy-1-[(1S)-11-hydroxy-4,17,17-trimethyl-18-[3-oxo-1-(2-oxoethoxy)propoxy]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-methylpropyl] acetate (PubChem CID 144551382) has the molecular formula C35H54O9 and a molecular weight of 618.81 g/mol. Its IUPAC name is [(1S)-2-hydroxy-1-[(1S)-11-hydroxy-4,17,17-trimethyl-18-[3-oxo-1-(2-oxoethoxy)propoxy]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-methylpropyl] acetate.
| Compound Name | [(1S)-2-hydroxy-1-[(1S)-11-hydroxy-4,17,17-trimethyl-18-[3-oxo-1-(2-oxoethoxy)propoxy]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 144551382 |
| Molecular Formula | C35H54O9 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | [(1S)-2-hydroxy-1-[(1S)-11-hydroxy-4,17,17-trimethyl-18-[3-oxo-1-(2-oxoethoxy)propoxy]-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-methylpropyl] acetate |
| SMILES | CC(=O)O[C@@H](C1CCC2C(O1)C(O)C1C3CCC4C(C)(C)C(OC(CC=O)OCC=O)CCC45C[C@@]35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C35H54O9/c1-20(38)42-30(32(4,5)40)23-9-7-22-29(43-23)28(39)27-21-8-10-24-31(2,3)25(44-26(12-16-36)41-18-17-37)11-13-35(24)19-34(21,35)15-14-33(22,27)6/h16-17,21-30,39-40H,7-15,18-19H2,1-6H3/t21?,22?,23?,24?,25?,26?,27?,28?,29?,30-,33?,34-,35?/m0/s1 |
| InChIKey | QFSXZZAERSGDSD-KPXWDDMLSA-N |
| XLogP | 4.38 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|