C40H35N3 — CID 144553842
N-[(1Z)-buta-1,3-dienyl]ethanimine;ethane;4-[6-(4-pyridin-4-ylphenyl)pyren-1-yl]pyridine (PubChem CID 144553842) has the molecular formula C40H35N3 and a molecular weight of 557.74 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]ethanimine;ethane;4-[6-(4-pyridin-4-ylphenyl)pyren-1-yl]pyridine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]ethanimine;ethane;4-[6-(4-pyridin-4-ylphenyl)pyren-1-yl]pyridine |
|---|---|
| PubChem CID | 144553842 |
| Molecular Formula | C40H35N3 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]ethanimine;ethane;4-[6-(4-pyridin-4-ylphenyl)pyren-1-yl]pyridine |
| SMILES | C=C/C=C\N=C\C.CC.c1cc(-c2ccc(-c3ccc4ccc5c(-c6ccncc6)ccc6ccc3c4c65)cc2)ccn1 |
| InChI | InChI=1S/C32H20N2.C6H9N.C2H6/c1-3-23(4-2-21(1)22-13-17-33-18-14-22)27-9-5-25-8-12-30-28(24-15-19-34-20-16-24)10-6-26-7-11-29(27)31(25)32(26)30;1-3-5-6-7-4-2;1-2/h1-20H;3-6H,1H2,2H3;1-2H3/b;6-5-,7-4+; |
| InChIKey | HJFIQOKFBPBYHA-YGWLYJDPSA-N |
| XLogP | 11.18 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|