C19H26FN7O — CID 144556313
1-[2-[(1R)-1-aminoethyl]-4-(diazenylmethyl)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 144556313) has the molecular formula C19H26FN7O and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-[2-[(1R)-1-aminoethyl]-4-(diazenylmethyl)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[2-[(1R)-1-aminoethyl]-4-(diazenylmethyl)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144556313 |
| Molecular Formula | C19H26FN7O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[2-[(1R)-1-aminoethyl]-4-(diazenylmethyl)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | [H]/N=N/CC1CCC(n2cc(C(N)=O)c(Nc3ccc(F)cc3)n2)C([C@@H](C)N)C1 |
| InChI | InChI=1S/C19H26FN7O/c1-11(21)15-8-12(9-24-23)2-7-17(15)27-10-16(18(22)28)19(26-27)25-14-5-3-13(20)4-6-14/h3-6,10-12,15,17,23H,2,7-9,21H2,1H3,(H2,22,28)(H,25,26)/b24-23+/t11-,12?,15?,17?/m1/s1 |
| InChIKey | PDVUHAYYDMOSBQ-KVTYXFESSA-N |
| XLogP | 3.20 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|