C21H21NO3 — CID 144560014
5-[[6-cyclopropyl-2-(1-methylcyclopropyl)-1H-indol-3-yl]methyl]furan-2-carboxylic acid (PubChem CID 144560014) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-[[6-cyclopropyl-2-(1-methylcyclopropyl)-1H-indol-3-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[6-cyclopropyl-2-(1-methylcyclopropyl)-1H-indol-3-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 144560014 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-[[6-cyclopropyl-2-(1-methylcyclopropyl)-1H-indol-3-yl]methyl]furan-2-carboxylic acid |
| SMILES | CC1(c2[nH]c3cc(C4CC4)ccc3c2Cc2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C21H21NO3/c1-21(8-9-21)19-16(11-14-5-7-18(25-14)20(23)24)15-6-4-13(12-2-3-12)10-17(15)22-19/h4-7,10,12,22H,2-3,8-9,11H2,1H3,(H,23,24) |
| InChIKey | ODUXUBLANPLZPL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |