C16H26OS — CID 144560670
3-[3-(2,2-dimethylpentan-3-yl)phenoxy]propane-1-thiol (PubChem CID 144560670) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylpentan-3-yl)phenoxy]propane-1-thiol.
| Compound Name | 3-[3-(2,2-dimethylpentan-3-yl)phenoxy]propane-1-thiol |
|---|---|
| PubChem CID | 144560670 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-[3-(2,2-dimethylpentan-3-yl)phenoxy]propane-1-thiol |
| SMILES | CCC(c1cccc(OCCCS)c1)C(C)(C)C |
| InChI | InChI=1S/C16H26OS/c1-5-15(16(2,3)4)13-8-6-9-14(12-13)17-10-7-11-18/h6,8-9,12,15,18H,5,7,10-11H2,1-4H3 |
| InChIKey | SCRIUKHBGVNOMC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|