C24H36S — CID 144561406
4-[3-[3-(2,2-dimethylpentan-3-yl)phenyl]propyl]benzenethiol;ethane (PubChem CID 144561406) has the molecular formula C24H36S and a molecular weight of 356.62 g/mol. Its IUPAC name is 4-[3-[3-(2,2-dimethylpentan-3-yl)phenyl]propyl]benzenethiol;ethane.
| Compound Name | 4-[3-[3-(2,2-dimethylpentan-3-yl)phenyl]propyl]benzenethiol;ethane |
|---|---|
| PubChem CID | 144561406 |
| Molecular Formula | C24H36S |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4-[3-[3-(2,2-dimethylpentan-3-yl)phenyl]propyl]benzenethiol;ethane |
| SMILES | CC.CCC(c1cccc(CCCc2ccc(S)cc2)c1)C(C)(C)C |
| InChI | InChI=1S/C22H30S.C2H6/c1-5-21(22(2,3)4)19-11-7-10-18(16-19)9-6-8-17-12-14-20(23)15-13-17;1-2/h7,10-16,21,23H,5-6,8-9H2,1-4H3;1-2H3 |
| InChIKey | MRLULUKPQGXVLN-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|