About benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine
benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine (PubChem CID 144560903) has the molecular formula C22H26NS+
and a molecular weight of 336.52 g/mol. Its IUPAC name is benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine.
Molecular Properties
| Compound Name | benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine |
| PubChem CID | 144560903 |
| Molecular Formula | C22H26NS+ |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine |
| SMILES | C/C=C\N.C[S+](c1ccccc1)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C13H13S.C6H6.C3H7N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-4-6-5-3-1;1-2-3-4/h2-11H,1H3;1-6H;2-3H,4H2,1H3/q+1;;/b;;3-2- |
| InChIKey | MATYXBMDDGIPAX-ZDEJHZIXSA-N |
| XLogP | 5.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine?
The IUPAC name of benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine (CID 144560903) is benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine.
What is the SMILES notation for benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine?
The canonical SMILES for benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine is C/C=C\N.C[S+](c1ccccc1)c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine?
The InChIKey is MATYXBMDDGIPAX-ZDEJHZIXSA-N. The full InChI is InChI=1S/C13H13S.C6H6.C3H7N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-4-6-5-3-1;1-2-3-4/h2-11H,1H3;1-6H;2-3H,4H2,1H3/q+1;;/b;;3-2-.
What are the key properties of benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine?
benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine has a molecular weight of 336.52 g/mol, XLogP of 5.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methyl(diphenyl)sulfanium;(Z)-prop-1-en-1-amine is sourced from PubChem (CID 144560903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).