C17H21S+ — CID 86723347
methyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium (PubChem CID 86723347) has the molecular formula C17H21S+ and a molecular weight of 257.42 g/mol. Its IUPAC name is methyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium.
| Compound Name | methyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
|---|---|
| PubChem CID | 86723347 |
| Molecular Formula | C17H21S+ |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
| SMILES | Cc1cc([S+](C)c2ccccc2)c(C)c(C)c1C |
| InChI | InChI=1S/C17H21S/c1-12-11-17(15(4)14(3)13(12)2)18(5)16-9-7-6-8-10-16/h6-11H,1-5H3/q+1 |
| InChIKey | ZONIBAOQFXPGBS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|