C17H23ClN2 — CID 158650690
phenyl-(2,3,4,5-tetramethylphenyl)methanediamine;hydrochloride (PubChem CID 158650690) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is phenyl-(2,3,4,5-tetramethylphenyl)methanediamine;hydrochloride.
| Compound Name | phenyl-(2,3,4,5-tetramethylphenyl)methanediamine;hydrochloride |
|---|---|
| PubChem CID | 158650690 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | phenyl-(2,3,4,5-tetramethylphenyl)methanediamine;hydrochloride |
| SMILES | Cc1cc(C(N)(N)c2ccccc2)c(C)c(C)c1C.Cl |
| InChI | InChI=1S/C17H22N2.ClH/c1-11-10-16(14(4)13(3)12(11)2)17(18,19)15-8-6-5-7-9-15;/h5-10H,18-19H2,1-4H3;1H |
| InChIKey | IBNAXEBJDLMZEX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|