C14H26O3 — CID 144564677
6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene (PubChem CID 144564677) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene.
| Compound Name | 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 144564677 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene |
| SMILES | C=C(C)OC.C=CC(=C)CCCOCCOC |
| InChI | InChI=1S/C10H18O2.C4H8O/c1-4-10(2)6-5-7-12-9-8-11-3;1-4(2)5-3/h4H,1-2,5-9H2,3H3;1H2,2-3H3 |
| InChIKey | CCWWIUWVQDMYFK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|