About 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene
6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene (PubChem CID 144564677) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene.
Molecular Properties
| Compound Name | 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene |
| PubChem CID | 144564677 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene |
| SMILES | C=C(C)OC.C=CC(=C)CCCOCCOC |
| InChI | InChI=1S/C10H18O2.C4H8O/c1-4-10(2)6-5-7-12-9-8-11-3;1-4(2)5-3/h4H,1-2,5-9H2,3H3;1H2,2-3H3 |
| InChIKey | CCWWIUWVQDMYFK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene?
The IUPAC name of 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene (CID 144564677) is 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene.
What is the SMILES notation for 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene?
The canonical SMILES for 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene is C=C(C)OC.C=CC(=C)CCCOCCOC.
What is the InChIKey of 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene?
The InChIKey is CCWWIUWVQDMYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C4H8O/c1-4-10(2)6-5-7-12-9-8-11-3;1-4(2)5-3/h4H,1-2,5-9H2,3H3;1H2,2-3H3.
What are the key properties of 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene?
6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene has a molecular weight of 242.36 g/mol, XLogP of 3.34, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyethoxy)-3-methylidenehex-1-ene;2-methoxyprop-1-ene is sourced from PubChem (CID 144564677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).