C21H22N8O4 — CID 144566273
N-[3-[6-amino-9-[(5S)-3-hydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-methylpyridine-3-carboxamide (PubChem CID 144566273) has the molecular formula C21H22N8O4 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[3-[6-amino-9-[(5S)-3-hydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[3-[6-amino-9-[(5S)-3-hydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 144566273 |
| Molecular Formula | C21H22N8O4 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-[6-amino-9-[(5S)-3-hydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1CC(O)C(n2cnc3c(N)nc(C#CCN(C)C(=O)c4cccnc4)nc32)O1 |
| InChI | InChI=1S/C21H22N8O4/c1-23-19(31)14-9-13(30)21(33-14)29-11-25-16-17(22)26-15(27-18(16)29)6-4-8-28(2)20(32)12-5-3-7-24-10-12/h3,5,7,10-11,13-14,21,30H,8-9H2,1-2H3,(H,23,31)(H2,22,26,27)/t13?,14-,21?/m0/s1 |
| InChIKey | LSRXSOGXAMGSIV-GJGORFQUSA-N |
| XLogP | -0.68 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|