C17H17FN4O — CID 144566463
N-[2-[5-(3-fluoro-2-methylquinoxalin-5-yl)-3-methyl-1H-pyrrol-2-yl]ethyl]formamide (PubChem CID 144566463) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[2-[5-(3-fluoro-2-methylquinoxalin-5-yl)-3-methyl-1H-pyrrol-2-yl]ethyl]formamide.
| Compound Name | N-[2-[5-(3-fluoro-2-methylquinoxalin-5-yl)-3-methyl-1H-pyrrol-2-yl]ethyl]formamide |
|---|---|
| PubChem CID | 144566463 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[2-[5-(3-fluoro-2-methylquinoxalin-5-yl)-3-methyl-1H-pyrrol-2-yl]ethyl]formamide |
| SMILES | Cc1cc(-c2cccc3nc(C)c(F)nc23)[nH]c1CCNC=O |
| InChI | InChI=1S/C17H17FN4O/c1-10-8-15(21-13(10)6-7-19-9-23)12-4-3-5-14-16(12)22-17(18)11(2)20-14/h3-5,8-9,21H,6-7H2,1-2H3,(H,19,23) |
| InChIKey | HAWVLMJFHGLCCG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|