C24H23N5O — CID 144566559
7-but-2-ynyl-2-[3-(but-2-ynylamino)-2-methylquinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 144566559) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 7-but-2-ynyl-2-[3-(but-2-ynylamino)-2-methylquinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 7-but-2-ynyl-2-[3-(but-2-ynylamino)-2-methylquinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 144566559 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 7-but-2-ynyl-2-[3-(but-2-ynylamino)-2-methylquinoxalin-5-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | CC#CCNc1nc2c(-c3cc4c([nH]3)C(CC#CC)CNC4=O)cccc2nc1C |
| InChI | InChI=1S/C24H23N5O/c1-4-6-9-16-14-26-24(30)18-13-20(28-21(16)18)17-10-8-11-19-22(17)29-23(15(3)27-19)25-12-7-5-2/h8,10-11,13,16,28H,9,12,14H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | RYNWTLRZUITTNV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|