C24H27N5O2 — CID 90035107
(7S)-2-[3-(5-hydroxypent-1-en-3-ylamino)-2-methylquinoxalin-5-yl]-7-prop-2-enyl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 90035107) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (7S)-2-[3-(5-hydroxypent-1-en-3-ylamino)-2-methylquinoxalin-5-yl]-7-prop-2-enyl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | (7S)-2-[3-(5-hydroxypent-1-en-3-ylamino)-2-methylquinoxalin-5-yl]-7-prop-2-enyl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 90035107 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (7S)-2-[3-(5-hydroxypent-1-en-3-ylamino)-2-methylquinoxalin-5-yl]-7-prop-2-enyl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | C=CC[C@H]1CNC(=O)c2cc(-c3cccc4nc(C)c(NC(C=C)CCO)nc34)[nH]c21 |
| InChI | InChI=1S/C24H27N5O2/c1-4-7-15-13-25-24(31)18-12-20(28-21(15)18)17-8-6-9-19-22(17)29-23(14(3)26-19)27-16(5-2)10-11-30/h4-6,8-9,12,15-16,28,30H,1-2,7,10-11,13H2,3H3,(H,25,31)(H,27,29)/t15-,16?/m0/s1 |
| InChIKey | QQASPCBCPKSREG-VYRBHSGPSA-N |
| XLogP | 3.69 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|