C27H26N4O2 — CID 144568201
(2E)-2-[(methylideneamino)methylidene]-N-[5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-2-pyridinyl]but-3-enamide (PubChem CID 144568201) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2E)-2-[(methylideneamino)methylidene]-N-[5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-2-pyridinyl]but-3-enamide.
| Compound Name | (2E)-2-[(methylideneamino)methylidene]-N-[5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-2-pyridinyl]but-3-enamide |
|---|---|
| PubChem CID | 144568201 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (2E)-2-[(methylideneamino)methylidene]-N-[5-[(E)-3-oxo-3-(5-phenyl-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl)prop-1-enyl]-2-pyridinyl]but-3-enamide |
| SMILES | C=C/C(=C\N=C)C(=O)Nc1ccc(/C=C/C(=O)N2CC3C=C(c4ccccc4)CC3C2)cn1 |
| InChI | InChI=1S/C27H26N4O2/c1-3-20(16-28-2)27(33)30-25-11-9-19(15-29-25)10-12-26(32)31-17-23-13-22(14-24(23)18-31)21-7-5-4-6-8-21/h3-13,15-16,23-24H,1-2,14,17-18H2,(H,29,30,33)/b12-10+,20-16+ |
| InChIKey | QEYCRXWYDGYBCO-KLGBTMNESA-N |
| XLogP | 4.37 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|