C17H11BrFIN4S — CID 144568326
[5-bromo-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite (PubChem CID 144568326) has the molecular formula C17H11BrFIN4S and a molecular weight of 529.18 g/mol. Its IUPAC name is [5-bromo-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite.
| Compound Name | [5-bromo-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 144568326 |
| Molecular Formula | C17H11BrFIN4S |
| Molecular Weight | 529.18 g/mol |
| Exact Mass | 527.89 |
| IUPAC Name | [5-bromo-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]pyrrolo[2,3-b]pyridin-1-yl] thiohypoiodite |
| SMILES | Fc1ccc(Cn2cc(-c3cn(SI)c4ncc(Br)cc34)cn2)cc1 |
| InChI | InChI=1S/C17H11BrFIN4S/c18-13-5-15-16(10-24(25-20)17(15)21-7-13)12-6-22-23(9-12)8-11-1-3-14(19)4-2-11/h1-7,9-10H,8H2 |
| InChIKey | VUZRMHJEYUPDQI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.18 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|