C28H34F6N2O2 — CID 144570560
propan-2-yl 1-[[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methyl]piperidine-4-carboximidate (PubChem CID 144570560) has the molecular formula C28H34F6N2O2 and a molecular weight of 544.58 g/mol. Its IUPAC name is propan-2-yl 1-[[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methyl]piperidine-4-carboximidate.
| Compound Name | propan-2-yl 1-[[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methyl]piperidine-4-carboximidate |
|---|---|
| PubChem CID | 144570560 |
| Molecular Formula | C28H34F6N2O2 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | propan-2-yl 1-[[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-1-yl]methyl]piperidine-4-carboximidate |
| SMILES | [H]/N=C(\OC(C)C)C1CCN(Cc2cccc3ccc(OC4CCC(C(F)(F)F)CC4)c(C(F)(F)F)c23)CC1 |
| InChI | InChI=1S/C28H34F6N2O2/c1-17(2)37-26(35)19-12-14-36(15-13-19)16-20-5-3-4-18-6-11-23(25(24(18)20)28(32,33)34)38-22-9-7-21(8-10-22)27(29,30)31/h3-6,11,17,19,21-22,35H,7-10,12-16H2,1-2H3/b35-26- |
| InChIKey | APVWCQOHEDWNGB-JYUHDHNASA-N |
| XLogP | 7.97 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|