About (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane
(2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane (PubChem CID 144573581) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane |
| PubChem CID | 144573581 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane |
| SMILES | CC#CCOc1ccc(C[C@H](N)C=O)cc1.COC |
| InChI | InChI=1S/C13H15NO2.C2H6O/c1-2-3-8-16-13-6-4-11(5-7-13)9-12(14)10-15;1-3-2/h4-7,10,12H,8-9,14H2,1H3;1-2H3/t12-;/m0./s1 |
| InChIKey | MQZQUIXVJYUNEV-YDALLXLXSA-N |
| XLogP | 1.42 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane?
The IUPAC name of (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane (CID 144573581) is (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane.
What is the SMILES notation for (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane?
The canonical SMILES for (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane is CC#CCOc1ccc(C[C@H](N)C=O)cc1.COC.
What is the InChIKey of (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane?
The InChIKey is MQZQUIXVJYUNEV-YDALLXLXSA-N. The full InChI is InChI=1S/C13H15NO2.C2H6O/c1-2-3-8-16-13-6-4-11(5-7-13)9-12(14)10-15;1-3-2/h4-7,10,12H,8-9,14H2,1H3;1-2H3/t12-;/m0./s1.
What are the key properties of (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane?
(2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane has a molecular weight of 263.34 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanal;methoxymethane is sourced from PubChem (CID 144573581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).