About (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate
(2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate (PubChem CID 90060076) has the molecular formula C16H19NO5
and a molecular weight of 305.33 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate |
| PubChem CID | 90060076 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate |
| SMILES | CC#CCOc1ccc(C[C@H](N)C(=O)OCC(=O)OC)cc1 |
| InChI | InChI=1S/C16H19NO5/c1-3-4-9-21-13-7-5-12(6-8-13)10-14(17)16(19)22-11-15(18)20-2/h5-8,14H,9-11,17H2,1-2H3/t14-/m0/s1 |
| InChIKey | PYZVHUYUBHWZIG-AWEZNQCLSA-N |
| XLogP | 0.67 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate?
The IUPAC name of (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate (CID 90060076) is (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate is CC#CCOc1ccc(C[C@H](N)C(=O)OCC(=O)OC)cc1.
What is the InChIKey of (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate?
The InChIKey is PYZVHUYUBHWZIG-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H19NO5/c1-3-4-9-21-13-7-5-12(6-8-13)10-14(17)16(19)22-11-15(18)20-2/h5-8,14H,9-11,17H2,1-2H3/t14-/m0/s1.
What are the key properties of (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate?
(2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate has a molecular weight of 305.33 g/mol, XLogP of 0.67, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) (2S)-2-amino-3-(4-but-2-ynoxyphenyl)propanoate is sourced from PubChem (CID 90060076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).