C17H21NO8 — CID 124560395
(2-methoxy-2-oxoethyl) (2R)-2-acetamido-3-[4-(2-methoxy-2-oxoethoxy)phenyl]propanoate (PubChem CID 124560395) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) (2R)-2-acetamido-3-[4-(2-methoxy-2-oxoethoxy)phenyl]propanoate.
| Compound Name | (2-methoxy-2-oxoethyl) (2R)-2-acetamido-3-[4-(2-methoxy-2-oxoethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 124560395 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2-methoxy-2-oxoethyl) (2R)-2-acetamido-3-[4-(2-methoxy-2-oxoethoxy)phenyl]propanoate |
| SMILES | COC(=O)COC(=O)[C@@H](Cc1ccc(OCC(=O)OC)cc1)NC(C)=O |
| InChI | InChI=1S/C17H21NO8/c1-11(19)18-14(17(22)26-10-16(21)24-3)8-12-4-6-13(7-5-12)25-9-15(20)23-2/h4-7,14H,8-10H2,1-3H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | IWOTXTCVZSVJBS-CQSZACIVSA-N |
| XLogP | 0.00 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|