About 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine
4-methyl-3-propan-2-yl-1,2-oxazol-5-amine (PubChem CID 14457874) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine |
| PubChem CID | 14457874 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine |
| SMILES | Cc1c(C(C)C)noc1N |
| InChI | InChI=1S/C7H12N2O/c1-4(2)6-5(3)7(8)10-9-6/h4H,8H2,1-3H3 |
| InChIKey | PSPCPJKZLWXHRV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine?
The IUPAC name of 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine (CID 14457874) is 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine.
What is the SMILES notation for 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine?
The canonical SMILES for 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine is Cc1c(C(C)C)noc1N.
What is the InChIKey of 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine?
The InChIKey is PSPCPJKZLWXHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-4(2)6-5(3)7(8)10-9-6/h4H,8H2,1-3H3.
What are the key properties of 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine?
4-methyl-3-propan-2-yl-1,2-oxazol-5-amine has a molecular weight of 140.19 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-propan-2-yl-1,2-oxazol-5-amine is sourced from PubChem (CID 14457874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).