C39H56N2O2 — CID 144579515
(3R,5R)-3,5-dimethylheptan-4-ol;N-[(Z)-pent-3-en-2-yl]methanimine;1-[2,3,5-trimethyl-4-[4-(4-methylphenyl)phenyl]anilino]ethenol (PubChem CID 144579515) has the molecular formula C39H56N2O2 and a molecular weight of 584.89 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethylheptan-4-ol;N-[(Z)-pent-3-en-2-yl]methanimine;1-[2,3,5-trimethyl-4-[4-(4-methylphenyl)phenyl]anilino]ethenol.
| Compound Name | (3R,5R)-3,5-dimethylheptan-4-ol;N-[(Z)-pent-3-en-2-yl]methanimine;1-[2,3,5-trimethyl-4-[4-(4-methylphenyl)phenyl]anilino]ethenol |
|---|---|
| PubChem CID | 144579515 |
| Molecular Formula | C39H56N2O2 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | (3R,5R)-3,5-dimethylheptan-4-ol;N-[(Z)-pent-3-en-2-yl]methanimine;1-[2,3,5-trimethyl-4-[4-(4-methylphenyl)phenyl]anilino]ethenol |
| SMILES | C=C(O)Nc1cc(C)c(-c2ccc(-c3ccc(C)cc3)cc2)c(C)c1C.C=NC(C)/C=C\C.CC[C@@H](C)C(O)[C@H](C)CC |
| InChI | InChI=1S/C24H25NO.C9H20O.C6H11N/c1-15-6-8-20(9-7-15)21-10-12-22(13-11-21)24-16(2)14-23(25-19(5)26)17(3)18(24)4;1-5-7(3)9(10)8(4)6-2;1-4-5-6(2)7-3/h6-14,25-26H,5H2,1-4H3;7-10H,5-6H2,1-4H3;4-6H,3H2,1-2H3/b;;5-4-/t;7-,8-;/m.1./s1 |
| InChIKey | XGDBOCVWPFPPRK-AXJBKZPFSA-N |
| XLogP | 10.79 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|