C14H20 — CID 160716023
2-[(E,3R)-hex-4-en-3-yl]-1,4-dimethylbenzene (PubChem CID 160716023) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-[(E,3R)-hex-4-en-3-yl]-1,4-dimethylbenzene.
| Compound Name | 2-[(E,3R)-hex-4-en-3-yl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 160716023 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-[(E,3R)-hex-4-en-3-yl]-1,4-dimethylbenzene |
| SMILES | C/C=C/[C@@H](CC)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H20/c1-5-7-13(6-2)14-10-11(3)8-9-12(14)4/h5,7-10,13H,6H2,1-4H3/b7-5+/t13-/m1/s1 |
| InChIKey | RSMFTPWQSUSOGH-VUDGCMKMSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|