C27H33N — CID 142873318
10-ethynyl-3-methyl-N-[(4E,6Z)-8-methyldeca-1,4,6-trien-4-yl]-9-[(Z)-prop-1-enyl]cyclodeca-1,3,5,7,9-pentaen-1-amine (PubChem CID 142873318) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is 10-ethynyl-3-methyl-N-[(4E,6Z)-8-methyldeca-1,4,6-trien-4-yl]-9-[(Z)-prop-1-enyl]cyclodeca-1,3,5,7,9-pentaen-1-amine.
| Compound Name | 10-ethynyl-3-methyl-N-[(4E,6Z)-8-methyldeca-1,4,6-trien-4-yl]-9-[(Z)-prop-1-enyl]cyclodeca-1,3,5,7,9-pentaen-1-amine |
|---|---|
| PubChem CID | 142873318 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 10-ethynyl-3-methyl-N-[(4E,6Z)-8-methyldeca-1,4,6-trien-4-yl]-9-[(Z)-prop-1-enyl]cyclodeca-1,3,5,7,9-pentaen-1-amine |
| SMILES | C#Cc1c(/C=C\C)cccccc(C)cc1N/C(=C/C=C\C(C)CC)CC=C |
| InChI | InChI=1S/C27H33N/c1-7-15-24-19-13-11-12-17-23(6)21-27(26(24)10-4)28-25(16-8-2)20-14-18-22(5)9-3/h4,7-8,11-15,17-22,28H,2,9,16H2,1,3,5-6H3/b12-11-,13-11-,15-7-,17-12-,18-14-,19-13+,23-17+,23-21+,24-19+,25-20+,26-24-,27-21+,27-26+ |
| InChIKey | NDHXHMNLGQXGEJ-BOURLDOYSA-N |
| XLogP | 7.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|