C36H47N3 — CID 143819001
2-methylprop-1-ene;4-[2-methyl-3-[(Z)-prop-1-enyl]anilino]-5-[(E)-3-propylhex-1-enyl]pyridine-3-carbonitrile;toluene (PubChem CID 143819001) has the molecular formula C36H47N3 and a molecular weight of 521.79 g/mol. Its IUPAC name is 2-methylprop-1-ene;4-[2-methyl-3-[(Z)-prop-1-enyl]anilino]-5-[(E)-3-propylhex-1-enyl]pyridine-3-carbonitrile;toluene.
| Compound Name | 2-methylprop-1-ene;4-[2-methyl-3-[(Z)-prop-1-enyl]anilino]-5-[(E)-3-propylhex-1-enyl]pyridine-3-carbonitrile;toluene |
|---|---|
| PubChem CID | 143819001 |
| Molecular Formula | C36H47N3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.38 |
| IUPAC Name | 2-methylprop-1-ene;4-[2-methyl-3-[(Z)-prop-1-enyl]anilino]-5-[(E)-3-propylhex-1-enyl]pyridine-3-carbonitrile;toluene |
| SMILES | C/C=C\c1cccc(Nc2c(C#N)cncc2/C=C/C(CCC)CCC)c1C.C=C(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C25H31N3.C7H8.C4H8/c1-5-9-20(10-6-2)14-15-22-17-27-18-23(16-26)25(22)28-24-13-8-12-21(11-7-3)19(24)4;1-7-5-3-2-4-6-7;1-4(2)3/h7-8,11-15,17-18,20H,5-6,9-10H2,1-4H3,(H,27,28);2-6H,1H3;1H2,2-3H3/b11-7-,15-14+;; |
| InChIKey | VDDXMFLTASHYFC-GGFLGZGOSA-N |
| XLogP | 10.85 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|