C18H24N2 — CID 123765844
N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(2-methylpropyl)benzenecarboximidamide (PubChem CID 123765844) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(2-methylpropyl)benzenecarboximidamide.
| Compound Name | N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(2-methylpropyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123765844 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(2-methylpropyl)benzenecarboximidamide |
| SMILES | C=CC=CC(=C)N(C)/C(=N\CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H24N2/c1-6-7-11-16(4)20(5)18(19-14-15(2)3)17-12-9-8-10-13-17/h6-13,15H,1,4,14H2,2-3,5H3/b11-7?,19-18- |
| InChIKey | UKLQKUGAVSRDNS-DPODPGQASA-N |
| XLogP | 4.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|