C9H16N2O — CID 174258657
[[[(3Z)-hexa-1,3,5-trien-2-yl]-methylamino]-methylamino]methanol (PubChem CID 174258657) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is [[[(3Z)-hexa-1,3,5-trien-2-yl]-methylamino]-methylamino]methanol.
| Compound Name | [[[(3Z)-hexa-1,3,5-trien-2-yl]-methylamino]-methylamino]methanol |
|---|---|
| PubChem CID | 174258657 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | [[[(3Z)-hexa-1,3,5-trien-2-yl]-methylamino]-methylamino]methanol |
| SMILES | C=C/C=C\C(=C)N(C)N(C)CO |
| InChI | InChI=1S/C9H16N2O/c1-5-6-7-9(2)11(4)10(3)8-12/h5-7,12H,1-2,8H2,3-4H3/b7-6- |
| InChIKey | BVZFUUGOPKYCIZ-SREVYHEPSA-N |
| XLogP | 0.97 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|