C15H18N2 — CID 123787370
N-hexa-1,3,5-trien-2-yl-N,N'-dimethylbenzenecarboximidamide (PubChem CID 123787370) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-2-yl-N,N'-dimethylbenzenecarboximidamide.
| Compound Name | N-hexa-1,3,5-trien-2-yl-N,N'-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 123787370 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-hexa-1,3,5-trien-2-yl-N,N'-dimethylbenzenecarboximidamide |
| SMILES | C=CC=CC(=C)N(C)/C(=N\C)c1ccccc1 |
| InChI | InChI=1S/C15H18N2/c1-5-6-10-13(2)17(4)15(16-3)14-11-8-7-9-12-14/h5-12H,1-2H2,3-4H3/b10-6?,16-15- |
| InChIKey | QCNYKZIXTNDVMF-QGTCFMHYSA-N |
| XLogP | 3.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|