C18H23ClN2 — CID 145333868
(1Z,3Z,4E,6Z)-3-(chloromethylimino)-1-phenylnona-1,4,6,8-tetraen-1-amine;ethane (PubChem CID 145333868) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is (1Z,3Z,4E,6Z)-3-(chloromethylimino)-1-phenylnona-1,4,6,8-tetraen-1-amine;ethane.
| Compound Name | (1Z,3Z,4E,6Z)-3-(chloromethylimino)-1-phenylnona-1,4,6,8-tetraen-1-amine;ethane |
|---|---|
| PubChem CID | 145333868 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1Z,3Z,4E,6Z)-3-(chloromethylimino)-1-phenylnona-1,4,6,8-tetraen-1-amine;ethane |
| SMILES | C=C/C=C\C=C\C(\C=C(/N)c1ccccc1)=N\CCl.CC |
| InChI | InChI=1S/C16H17ClN2.C2H6/c1-2-3-4-8-11-15(19-13-17)12-16(18)14-9-6-5-7-10-14;1-2/h2-12H,1,13,18H2;1-2H3/b4-3-,11-8+,16-12-,19-15-; |
| InChIKey | MAIGEIPHZIMRHB-SUAIXIIGSA-N |
| XLogP | 4.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|