C17H22N2 — CID 144956917
(1Z,5Z,7Z)-3-N-methyl-1-phenyldeca-1,5,7,9-tetraene-1,3-diamine (PubChem CID 144956917) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (1Z,5Z,7Z)-3-N-methyl-1-phenyldeca-1,5,7,9-tetraene-1,3-diamine.
| Compound Name | (1Z,5Z,7Z)-3-N-methyl-1-phenyldeca-1,5,7,9-tetraene-1,3-diamine |
|---|---|
| PubChem CID | 144956917 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (1Z,5Z,7Z)-3-N-methyl-1-phenyldeca-1,5,7,9-tetraene-1,3-diamine |
| SMILES | C=C/C=C\C=C/CC(/C=C(\N)c1ccccc1)NC |
| InChI | InChI=1S/C17H22N2/c1-3-4-5-6-10-13-16(19-2)14-17(18)15-11-8-7-9-12-15/h3-12,14,16,19H,1,13,18H2,2H3/b5-4-,10-6-,17-14- |
| InChIKey | UUKHCBCXEYXKTK-SELLJPFNSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|