C21H27N — CID 142981330
1-ethyl-4-[(3Z,5Z)-1-phenylocta-3,5,7-trienylidene]piperidine (PubChem CID 142981330) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-ethyl-4-[(3Z,5Z)-1-phenylocta-3,5,7-trienylidene]piperidine.
| Compound Name | 1-ethyl-4-[(3Z,5Z)-1-phenylocta-3,5,7-trienylidene]piperidine |
|---|---|
| PubChem CID | 142981330 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-ethyl-4-[(3Z,5Z)-1-phenylocta-3,5,7-trienylidene]piperidine |
| SMILES | C=C/C=C\C=C/CC(=C1CCN(CC)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H27N/c1-3-5-6-7-11-14-21(19-12-9-8-10-13-19)20-15-17-22(4-2)18-16-20/h3,5-13H,1,4,14-18H2,2H3/b6-5-,11-7- |
| InChIKey | YRPLHNAQXIXRAV-FUVGTJSASA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|