C23H26ClF2N5O6 — CID 144579748
1-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]azetidin-3-ol;2-amino-2,2-difluoroethanol (PubChem CID 144579748) has the molecular formula C23H26ClF2N5O6 and a molecular weight of 541.94 g/mol. Its IUPAC name is 1-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]azetidin-3-ol;2-amino-2,2-difluoroethanol.
| Compound Name | 1-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]azetidin-3-ol;2-amino-2,2-difluoroethanol |
|---|---|
| PubChem CID | 144579748 |
| Molecular Formula | C23H26ClF2N5O6 |
| Molecular Weight | 541.94 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]azetidin-3-ol;2-amino-2,2-difluoroethanol |
| SMILES | NC(F)(F)CO.OC1CN(c2ccc(-c3nc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)C1 |
| InChI | InChI=1S/C21H21ClN4O5.C2H5F2NO/c22-13-5-14-20(24-17(13)10-1-3-11(4-2-10)26-6-12(27)7-26)25-21(23-14)31-16-9-30-18-15(28)8-29-19(16)18;3-2(4,5)1-6/h1-5,12,15-16,18-19,27-28H,6-9H2,(H,23,24,25);6H,1,5H2/t15-,16-,18-,19-;/m1./s1 |
| InChIKey | BKFNYFAUWWJUQI-ZNSYCPMGSA-N |
| XLogP | 0.90 |
| TPSA | 159.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.94 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|