C29H22O3 — CID 144582522
18-ethenyl-19-[(E)-2-methoxyprop-1-enyl]-7-methyl-12,22-dioxahexacyclo[11.11.0.02,11.04,9.015,23.016,21]tetracosa-1(24),2(11),3,5,7,9,13,15(23),16(21),17,19-undecaene (PubChem CID 144582522) has the molecular formula C29H22O3 and a molecular weight of 418.49 g/mol. Its IUPAC name is 18-ethenyl-19-[(E)-2-methoxyprop-1-enyl]-7-methyl-12,22-dioxahexacyclo[11.11.0.02,11.04,9.015,23.016,21]tetracosa-1(24),2(11),3,5,7,9,13,15(23),16(21),17,19-undecaene.
| Compound Name | 18-ethenyl-19-[(E)-2-methoxyprop-1-enyl]-7-methyl-12,22-dioxahexacyclo[11.11.0.02,11.04,9.015,23.016,21]tetracosa-1(24),2(11),3,5,7,9,13,15(23),16(21),17,19-undecaene |
|---|---|
| PubChem CID | 144582522 |
| Molecular Formula | C29H22O3 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 18-ethenyl-19-[(E)-2-methoxyprop-1-enyl]-7-methyl-12,22-dioxahexacyclo[11.11.0.02,11.04,9.015,23.016,21]tetracosa-1(24),2(11),3,5,7,9,13,15(23),16(21),17,19-undecaene |
| SMILES | C=Cc1cc2c(cc1/C=C(\C)OC)oc1cc3c(cc12)oc1cc2cc(C)ccc2cc13 |
| InChI | InChI=1S/C29H22O3/c1-5-18-10-22-24-14-29-25(15-28(24)32-27(22)13-21(18)9-17(3)30-4)23-11-19-7-6-16(2)8-20(19)12-26(23)31-29/h5-15H,1H2,2-4H3/b17-9+ |
| InChIKey | ZJILHFJTEVZRLE-RQZCQDPDSA-N |
| XLogP | 8.60 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|