C15H17NS — CID 144582764
(4Z,7Z)-3-methylidene-2-thia-10-azabicyclo[9.4.1]hexadeca-1(16),4,7,12,14-pentaene (PubChem CID 144582764) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is (4Z,7Z)-3-methylidene-2-thia-10-azabicyclo[9.4.1]hexadeca-1(16),4,7,12,14-pentaene.
| Compound Name | (4Z,7Z)-3-methylidene-2-thia-10-azabicyclo[9.4.1]hexadeca-1(16),4,7,12,14-pentaene |
|---|---|
| PubChem CID | 144582764 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (4Z,7Z)-3-methylidene-2-thia-10-azabicyclo[9.4.1]hexadeca-1(16),4,7,12,14-pentaene |
| SMILES | C=C1/C=C\C/C=C\CNC2C=CC=CC(=C2)S1 |
| InChI | InChI=1S/C15H17NS/c1-13-8-4-2-3-7-11-16-14-9-5-6-10-15(12-14)17-13/h3-10,12,14,16H,1-2,11H2/b7-3-,8-4- |
| InChIKey | JECGQKJDIMMKEN-VHOZIDCHSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|