C8H9NS — CID 21467132
4,5-dihydro-3aH-thieno[3,2-b]azepine (PubChem CID 21467132) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 4,5-dihydro-3aH-thieno[3,2-b]azepine.
| Compound Name | 4,5-dihydro-3aH-thieno[3,2-b]azepine |
|---|---|
| PubChem CID | 21467132 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 4,5-dihydro-3aH-thieno[3,2-b]azepine |
| SMILES | C1=CCNC2C=CSC2=C1 |
| InChI | InChI=1S/C8H9NS/c1-2-5-9-7-4-6-10-8(7)3-1/h1-4,6-7,9H,5H2 |
| InChIKey | QMNLOPNUZORWEK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |