C9H11NS — CID 144794234
2,3,4,9-tetrahydrocyclohepta[b][1,4]thiazine (PubChem CID 144794234) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 2,3,4,9-tetrahydrocyclohepta[b][1,4]thiazine.
| Compound Name | 2,3,4,9-tetrahydrocyclohepta[b][1,4]thiazine |
|---|---|
| PubChem CID | 144794234 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2,3,4,9-tetrahydrocyclohepta[b][1,4]thiazine |
| SMILES | C1=CCC2=C(C=C1)NCCS2 |
| InChI | InChI=1S/C9H11NS/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-4,10H,5-7H2 |
| InChIKey | OPJIJCVRSYSWPA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |