C8H11NS — CID 121486631
2-methyl-2,3,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 121486631) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-methyl-2,3,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-methyl-2,3,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 121486631 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2-methyl-2,3,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | CC1NC2=C(CCC=C2)S1 |
| InChI | InChI=1S/C8H11NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2,4,6,9H,3,5H2,1H3 |
| InChIKey | YBBDLYXKMUQIDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |