C9H13NS — CID 138569579
2,5-dimethyl-2,3,4,5-tetrahydro-1,3-benzothiazole (PubChem CID 138569579) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 2,5-dimethyl-2,3,4,5-tetrahydro-1,3-benzothiazole.
| Compound Name | 2,5-dimethyl-2,3,4,5-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 138569579 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2,5-dimethyl-2,3,4,5-tetrahydro-1,3-benzothiazole |
| SMILES | CC1C=CC2=C(C1)NC(C)S2 |
| InChI | InChI=1S/C9H13NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-4,6-7,10H,5H2,1-2H3 |
| InChIKey | ZSYNEHNLPBPNSM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |