C6H11NS2 — CID 163654245
2,5-dihydro-1H-pyrrol-2-ylmethyl-methyl-sulfanylidene-λ4-sulfane (PubChem CID 163654245) has the molecular formula C6H11NS2 and a molecular weight of 161.30 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrol-2-ylmethyl-methyl-sulfanylidene-λ4-sulfane.
| Compound Name | 2,5-dihydro-1H-pyrrol-2-ylmethyl-methyl-sulfanylidene-λ4-sulfane |
|---|---|
| PubChem CID | 163654245 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.30 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 2,5-dihydro-1H-pyrrol-2-ylmethyl-methyl-sulfanylidene-λ4-sulfane |
| SMILES | CS(=S)CC1C=CCN1 |
| InChI | InChI=1S/C6H11NS2/c1-9(8)5-6-3-2-4-7-6/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | IOUORSPPPJTXSO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|