C52H50 — CID 144583790
1-[4-(2,2-diphenylethenyl)phenyl]-3-[4-[(1Z,3E,4Z)-3-ethylidene-2-phenylhepta-1,4,6-trienyl]phenyl]-5-propylbenzene;ethane (PubChem CID 144583790) has the molecular formula C52H50 and a molecular weight of 674.97 g/mol. Its IUPAC name is 1-[4-(2,2-diphenylethenyl)phenyl]-3-[4-[(1Z,3E,4Z)-3-ethylidene-2-phenylhepta-1,4,6-trienyl]phenyl]-5-propylbenzene;ethane.
| Compound Name | 1-[4-(2,2-diphenylethenyl)phenyl]-3-[4-[(1Z,3E,4Z)-3-ethylidene-2-phenylhepta-1,4,6-trienyl]phenyl]-5-propylbenzene;ethane |
|---|---|
| PubChem CID | 144583790 |
| Molecular Formula | C52H50 |
| Molecular Weight | 674.97 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | 1-[4-(2,2-diphenylethenyl)phenyl]-3-[4-[(1Z,3E,4Z)-3-ethylidene-2-phenylhepta-1,4,6-trienyl]phenyl]-5-propylbenzene;ethane |
| SMILES | C=C/C=C\C(=C/C)\C(=C\c1ccc(-c2cc(CCC)cc(-c3ccc(C=C(c4ccccc4)c4ccccc4)cc3)c2)cc1)c1ccccc1.CC |
| InChI | InChI=1S/C50H44.C2H6/c1-4-7-18-41(6-3)49(44-19-11-8-12-20-44)35-38-25-29-42(30-26-38)47-33-40(17-5-2)34-48(37-47)43-31-27-39(28-32-43)36-50(45-21-13-9-14-22-45)46-23-15-10-16-24-46;1-2/h4,6-16,18-37H,1,5,17H2,2-3H3;1-2H3/b18-7-,41-6+,49-35-; |
| InChIKey | RMHNYTKBUCTEET-ZOZZYOSESA-N |
| XLogP | 14.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.97 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|